C9H9N3O2S2 — CID 11988251
3-benzylsulfonyl-1,2,4-thiadiazol-5-amine (PubChem CID 11988251) has the molecular formula C9H9N3O2S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-benzylsulfonyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-benzylsulfonyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 11988251 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 3-benzylsulfonyl-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(S(=O)(=O)Cc2ccccc2)ns1 |
| InChI | InChI=1S/C9H9N3O2S2/c10-8-11-9(12-15-8)16(13,14)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11,12) |
| InChIKey | QSNVZCOWPJTFMF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |