C14H19Cl2N3OS — CID 119882710
3-amino-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide;dihydrochloride (PubChem CID 119882710) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is 3-amino-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide;dihydrochloride.
| Compound Name | 3-amino-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119882710 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 3-amino-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide;dihydrochloride |
| SMILES | Cc1nc(C)c(CCNC(=O)c2cccc(N)c2)s1.Cl.Cl |
| InChI | InChI=1S/C14H17N3OS.2ClH/c1-9-13(19-10(2)17-9)6-7-16-14(18)11-4-3-5-12(15)8-11;;/h3-5,8H,6-7,15H2,1-2H3,(H,16,18);2*1H |
| InChIKey | CBNRVCGLHYWCGQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|