C14H14F2N2OS — CID 7222725
N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,6-difluorobenzamide (PubChem CID 7222725) has the molecular formula C14H14F2N2OS and a molecular weight of 296.34 g/mol. Its IUPAC name is N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 7222725 |
| Molecular Formula | C14H14F2N2OS |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,6-difluorobenzamide |
| SMILES | Cc1nc(C)c(CCNC(=O)c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C14H14F2N2OS/c1-8-12(20-9(2)18-8)6-7-17-14(19)13-10(15)4-3-5-11(13)16/h3-5H,6-7H2,1-2H3,(H,17,19) |
| InChIKey | DIAUUERAIBOHBU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |