C16H27Cl2N3O — CID 119883155
1-amino-N-[3-[methyl(propan-2-yl)amino]phenyl]cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119883155) has the molecular formula C16H27Cl2N3O and a molecular weight of 348.32 g/mol. Its IUPAC name is 1-amino-N-[3-[methyl(propan-2-yl)amino]phenyl]cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-[3-[methyl(propan-2-yl)amino]phenyl]cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119883155 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-amino-N-[3-[methyl(propan-2-yl)amino]phenyl]cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | CC(C)N(C)c1cccc(NC(=O)C2(N)CCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O.2ClH/c1-12(2)19(3)14-8-6-7-13(11-14)18-15(20)16(17)9-4-5-10-16;;/h6-8,11-12H,4-5,9-10,17H2,1-3H3,(H,18,20);2*1H |
| InChIKey | LDEOAQZKLJSLRU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |