C20H27FN6O — CID 119883922
N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119883922) has the molecular formula C20H27FN6O and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119883922 |
| Molecular Formula | C20H27FN6O |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1cc(F)ccc1N1CCCC(NC(=O)c2cn(C3CCNCC3)nn2)C1 |
| InChI | InChI=1S/C20H27FN6O/c1-14-11-15(21)4-5-19(14)26-10-2-3-16(12-26)23-20(28)18-13-27(25-24-18)17-6-8-22-9-7-17/h4-5,11,13,16-17,22H,2-3,6-10,12H2,1H3,(H,23,28) |
| InChIKey | PPNMCOPWDHLGHM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |