C16H33Cl2N3O2 — CID 119886581
(2S)-2-amino-4-methyl-1-[4-(oxan-4-ylmethyl)piperazin-1-yl]pentan-1-one;dihydrochloride (PubChem CID 119886581) has the molecular formula C16H33Cl2N3O2 and a molecular weight of 370.37 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-1-[4-(oxan-4-ylmethyl)piperazin-1-yl]pentan-1-one;dihydrochloride.
| Compound Name | (2S)-2-amino-4-methyl-1-[4-(oxan-4-ylmethyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119886581 |
| Molecular Formula | C16H33Cl2N3O2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S)-2-amino-4-methyl-1-[4-(oxan-4-ylmethyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N1CCN(CC2CCOCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H31N3O2.2ClH/c1-13(2)11-15(17)16(20)19-7-5-18(6-8-19)12-14-3-9-21-10-4-14;;/h13-15H,3-12,17H2,1-2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | AGNXQKBDJXYAFS-CKUXDGONSA-N |
| XLogP | 1.77 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |