C16H33Cl2N3O — CID 120502799
3-amino-1-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride (PubChem CID 120502799) has the molecular formula C16H33Cl2N3O and a molecular weight of 354.37 g/mol. Its IUPAC name is 3-amino-1-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride.
| Compound Name | 3-amino-1-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120502799 |
| Molecular Formula | C16H33Cl2N3O |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-amino-1-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)N1CCN(CC2CCCCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H31N3O.2ClH/c1-13(14(2)17)16(20)19-10-8-18(9-11-19)12-15-6-4-3-5-7-15;;/h13-15H,3-12,17H2,1-2H3;2*1H |
| InChIKey | LSICIOXQDDPBAC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |