C15H30Cl2N4O2 — CID 119887626
3-amino-N-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]butanamide;dihydrochloride (PubChem CID 119887626) has the molecular formula C15H30Cl2N4O2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 3-amino-N-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119887626 |
| Molecular Formula | C15H30Cl2N4O2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-amino-N-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NCCN1CCN(C(=O)C2CCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H28N4O2.2ClH/c1-12(16)11-14(20)17-5-6-18-7-9-19(10-8-18)15(21)13-3-2-4-13;;/h12-13H,2-11,16H2,1H3,(H,17,20);2*1H |
| InChIKey | HXRQRNBCMUAPMM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |