C15H25Cl2F2N3O — CID 119889365
N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119889365) has the molecular formula C15H25Cl2F2N3O and a molecular weight of 372.29 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119889365 |
| Molecular Formula | C15H25Cl2F2N3O |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCC(c1c(F)cccc1F)N(C)C.Cl.Cl |
| InChI | InChI=1S/C15H23F2N3O.2ClH/c1-18-9-5-8-14(21)19-10-13(20(2)3)15-11(16)6-4-7-12(15)17;;/h4,6-7,13,18H,5,8-10H2,1-3H3,(H,19,21);2*1H |
| InChIKey | KXSKAWZMQGSEAT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|