C13H23N3OS — CID 119890059
N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]-4-(methylamino)butanamide (PubChem CID 119890059) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119890059 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NC(C)(C)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C13H23N3OS/c1-9-10(2)18-12(15-9)13(3,4)16-11(17)7-6-8-14-5/h14H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | QGUJNFSGQZMVMH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|