C15H22N2OS — CID 56793632
2-cyclopent-2-en-1-yl-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]acetamide (PubChem CID 56793632) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 56793632 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]acetamide |
| SMILES | Cc1nc(C(C)(C)NC(=O)CC2C=CCC2)sc1C |
| InChI | InChI=1S/C15H22N2OS/c1-10-11(2)19-14(16-10)15(3,4)17-13(18)9-12-7-5-6-8-12/h5,7,12H,6,8-9H2,1-4H3,(H,17,18) |
| InChIKey | KBHQMISIFSVSFT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|