C15H18N4OS — CID 24621135
2-cyclopent-2-en-1-yl-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 24621135) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24621135 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1nc(NC(=O)CC2C=CCC2)sc1-c1nccn1C |
| InChI | InChI=1S/C15H18N4OS/c1-10-13(14-16-7-8-19(14)2)21-15(17-10)18-12(20)9-11-5-3-4-6-11/h3,5,7-8,11H,4,6,9H2,1-2H3,(H,17,18,20) |
| InChIKey | HEERBHGLVNDFOP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|