C16H25N5O — CID 119890453
3-amino-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 119890453) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-amino-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119890453 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 3-amino-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)NCC2CCCN2c2cccnn2)C1 |
| InChI | InChI=1S/C16H25N5O/c17-13-5-1-4-12(10-13)16(22)18-11-14-6-3-9-21(14)15-7-2-8-19-20-15/h2,7-8,12-14H,1,3-6,9-11,17H2,(H,18,22) |
| InChIKey | GPURUQBIIDBQBJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |