C18H29N5O — CID 119890481
3-piperidin-4-yl-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]butanamide (PubChem CID 119890481) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]butanamide.
| Compound Name | 3-piperidin-4-yl-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 119890481 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 3-piperidin-4-yl-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]butanamide |
| SMILES | CC(CC(=O)NCC1CCCN1c1cccnn1)C1CCNCC1 |
| InChI | InChI=1S/C18H29N5O/c1-14(15-6-9-19-10-7-15)12-18(24)20-13-16-4-3-11-23(16)17-5-2-8-21-22-17/h2,5,8,14-16,19H,3-4,6-7,9-13H2,1H3,(H,20,24) |
| InChIKey | VMGVBWOGMXEEKL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |