C19H29N5O2 — CID 119890851
1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopentane-1-carboxamide (PubChem CID 119890851) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119890851 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopentane-1-carboxamide |
| SMILES | CN1CCC(NC(=O)Nc2ccc(NC(=O)C3(N)CCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H29N5O2/c1-24-12-8-16(9-13-24)23-18(26)22-15-6-4-14(5-7-15)21-17(25)19(20)10-2-3-11-19/h4-7,16H,2-3,8-13,20H2,1H3,(H,21,25)(H2,22,23,26) |
| InChIKey | MGHMTTLNQCQKGQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |