C17H25N5O2 — CID 119890827
1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopropane-1-carboxamide (PubChem CID 119890827) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119890827 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCC(NC(=O)Nc2ccc(NC(=O)C3(N)CC3)cc2)CC1 |
| InChI | InChI=1S/C17H25N5O2/c1-22-10-6-14(7-11-22)21-16(24)20-13-4-2-12(3-5-13)19-15(23)17(18)8-9-17/h2-5,14H,6-11,18H2,1H3,(H,19,23)(H2,20,21,24) |
| InChIKey | OJBWCFFXIWRKGM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |