C20H27Cl2N5O2 — CID 119890862
3-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]benzamide;dihydrochloride (PubChem CID 119890862) has the molecular formula C20H27Cl2N5O2 and a molecular weight of 440.38 g/mol. Its IUPAC name is 3-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]benzamide;dihydrochloride.
| Compound Name | 3-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119890862 |
| Molecular Formula | C20H27Cl2N5O2 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 3-amino-N-[4-[(1-methylpiperidin-4-yl)carbamoylamino]phenyl]benzamide;dihydrochloride |
| SMILES | CN1CCC(NC(=O)Nc2ccc(NC(=O)c3cccc(N)c3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H25N5O2.2ClH/c1-25-11-9-18(10-12-25)24-20(27)23-17-7-5-16(6-8-17)22-19(26)14-3-2-4-15(21)13-14;;/h2-8,13,18H,9-12,21H2,1H3,(H,22,26)(H2,23,24,27);2*1H |
| InChIKey | NIFMJJQXSODBLS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|