C20H25Cl2FN4O — CID 119890958
N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119890958) has the molecular formula C20H25Cl2FN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119890958 |
| Molecular Formula | C20H25Cl2FN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)Nc1ccc(-c2nc3cc(F)ccc3n2C)cc1C.Cl.Cl |
| InChI | InChI=1S/C20H23FN4O.2ClH/c1-13-11-14(6-8-16(13)23-19(26)5-4-10-22-2)20-24-17-12-15(21)7-9-18(17)25(20)3;;/h6-9,11-12,22H,4-5,10H2,1-3H3,(H,23,26);2*1H |
| InChIKey | UAKWLSKFGISGBL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|