C20H23FN4O — CID 119891017
2-amino-N-[5-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]pentanamide (PubChem CID 119891017) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-amino-N-[5-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]pentanamide.
| Compound Name | 2-amino-N-[5-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]pentanamide |
|---|---|
| PubChem CID | 119891017 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-amino-N-[5-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]pentanamide |
| SMILES | CCCC(N)C(=O)Nc1cc(-c2nc3cc(F)ccc3n2C)ccc1C |
| InChI | InChI=1S/C20H23FN4O/c1-4-5-15(22)20(26)24-16-10-13(7-6-12(16)2)19-23-17-11-14(21)8-9-18(17)25(19)3/h6-11,15H,4-5,22H2,1-3H3,(H,24,26) |
| InChIKey | KBDLBMHOZGWEOD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |