C19H25FN6O2 — CID 119892331
N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119892331) has the molecular formula C19H25FN6O2 and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119892331 |
| Molecular Formula | C19H25FN6O2 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NCC2CCCO2)c(F)c1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C19H25FN6O2/c20-16-10-13(3-4-17(16)22-11-15-2-1-9-28-15)23-19(27)18-12-26(25-24-18)14-5-7-21-8-6-14/h3-4,10,12,14-15,21-22H,1-2,5-9,11H2,(H,23,27) |
| InChIKey | XSTNLHBVIBNNCF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |