C16H24FN3O2 — CID 119892357
N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 119892357) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 119892357 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)Nc1ccc(NCC2CCCO2)c(F)c1 |
| InChI | InChI=1S/C16H24FN3O2/c1-11(9-18-2)16(21)20-12-5-6-15(14(17)8-12)19-10-13-4-3-7-22-13/h5-6,8,11,13,18-19H,3-4,7,9-10H2,1-2H3,(H,20,21) |
| InChIKey | OYNVMTGMRIHINU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |