C19H24FN3O2 — CID 56794269
1-cyano-N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]cyclohexane-1-carboxamide (PubChem CID 56794269) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-cyano-N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-cyano-N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 56794269 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-cyano-N-[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]cyclohexane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc(NCC3CCCO3)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C19H24FN3O2/c20-16-11-14(6-7-17(16)22-12-15-5-4-10-25-15)23-18(24)19(13-21)8-2-1-3-9-19/h6-7,11,15,22H,1-5,8-10,12H2,(H,23,24) |
| InChIKey | MCTNHPPCRCQYJG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |