C18H20N4O3 — CID 119893205
4-[5-[(1-aminocyclopropanecarbonyl)amino]-2-methylphenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 119893205) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[5-[(1-aminocyclopropanecarbonyl)amino]-2-methylphenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[5-[(1-aminocyclopropanecarbonyl)amino]-2-methylphenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 119893205 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[5-[(1-aminocyclopropanecarbonyl)amino]-2-methylphenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cc(NC(=O)C3(N)CC3)ccc2C)ccn1 |
| InChI | InChI=1S/C18H20N4O3/c1-11-3-4-12(22-17(24)18(19)6-7-18)9-15(11)25-13-5-8-21-14(10-13)16(23)20-2/h3-5,8-10H,6-7,19H2,1-2H3,(H,20,23)(H,22,24) |
| InChIKey | APZKZJAZROTPPL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |