C19H22N4O3 — CID 119893257
N-methyl-4-[2-methyl-5-(pyrrolidine-3-carbonylamino)phenoxy]pyridine-2-carboxamide (PubChem CID 119893257) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-methyl-4-[2-methyl-5-(pyrrolidine-3-carbonylamino)phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[2-methyl-5-(pyrrolidine-3-carbonylamino)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 119893257 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-methyl-4-[2-methyl-5-(pyrrolidine-3-carbonylamino)phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cc(NC(=O)C3CCNC3)ccc2C)ccn1 |
| InChI | InChI=1S/C19H22N4O3/c1-12-3-4-14(23-18(24)13-5-7-21-11-13)9-17(12)26-15-6-8-22-16(10-15)19(25)20-2/h3-4,6,8-10,13,21H,5,7,11H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | RQZLBNMHAWSZCF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |