C14H20N4O2 — CID 119893477
N-[2-(dimethylamino)-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide (PubChem CID 119893477) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(dimethylamino)-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119893477 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[2-(dimethylamino)-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc2oc(N(C)C)nc2c1 |
| InChI | InChI=1S/C14H20N4O2/c1-15-8-4-5-13(19)16-10-6-7-12-11(9-10)17-14(20-12)18(2)3/h6-7,9,15H,4-5,8H2,1-3H3,(H,16,19) |
| InChIKey | RXOPYOWXJDRHCX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|