C19H22N4O2 — CID 119893878
N-[5-[(3-aminocyclohexanecarbonyl)amino]-2-pyridinyl]benzamide (PubChem CID 119893878) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[5-[(3-aminocyclohexanecarbonyl)amino]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[(3-aminocyclohexanecarbonyl)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 119893878 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[5-[(3-aminocyclohexanecarbonyl)amino]-2-pyridinyl]benzamide |
| SMILES | NC1CCCC(C(=O)Nc2ccc(NC(=O)c3ccccc3)nc2)C1 |
| InChI | InChI=1S/C19H22N4O2/c20-15-8-4-7-14(11-15)19(25)22-16-9-10-17(21-12-16)23-18(24)13-5-2-1-3-6-13/h1-3,5-6,9-10,12,14-15H,4,7-8,11,20H2,(H,22,25)(H,21,23,24) |
| InChIKey | HTRIZDPUJNVNNK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |