C16H27Cl2N3O — CID 119894091
3-amino-N-methyl-N-[2-(1-methylpiperidin-2-yl)ethyl]benzamide;dihydrochloride (PubChem CID 119894091) has the molecular formula C16H27Cl2N3O and a molecular weight of 348.32 g/mol. Its IUPAC name is 3-amino-N-methyl-N-[2-(1-methylpiperidin-2-yl)ethyl]benzamide;dihydrochloride.
| Compound Name | 3-amino-N-methyl-N-[2-(1-methylpiperidin-2-yl)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119894091 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-amino-N-methyl-N-[2-(1-methylpiperidin-2-yl)ethyl]benzamide;dihydrochloride |
| SMILES | CN(CCC1CCCCN1C)C(=O)c1cccc(N)c1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O.2ClH/c1-18-10-4-3-8-15(18)9-11-19(2)16(20)13-6-5-7-14(17)12-13;;/h5-7,12,15H,3-4,8-11,17H2,1-2H3;2*1H |
| InChIKey | FWBQXHZDCORGML-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|