C20H25N3O2 — CID 121411267
[2-(3-aminophenyl)phenyl]-[2-(1-methylpyrrolidin-2-yl)ethyl]carbamic acid (PubChem CID 121411267) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [2-(3-aminophenyl)phenyl]-[2-(1-methylpyrrolidin-2-yl)ethyl]carbamic acid.
| Compound Name | [2-(3-aminophenyl)phenyl]-[2-(1-methylpyrrolidin-2-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 121411267 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [2-(3-aminophenyl)phenyl]-[2-(1-methylpyrrolidin-2-yl)ethyl]carbamic acid |
| SMILES | CN1CCCC1CCN(C(=O)O)c1ccccc1-c1cccc(N)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-22-12-5-8-17(22)11-13-23(20(24)25)19-10-3-2-9-18(19)15-6-4-7-16(21)14-15/h2-4,6-7,9-10,14,17H,5,8,11-13,21H2,1H3,(H,24,25) |
| InChIKey | PTGWPNSXLKGRSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|