C19H21FN2O2 — CID 121411237
[2-(3-fluorophenyl)phenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid (PubChem CID 121411237) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is [2-(3-fluorophenyl)phenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid.
| Compound Name | [2-(3-fluorophenyl)phenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 121411237 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [2-(3-fluorophenyl)phenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid |
| SMILES | CN1CCC[C@H]1CN(C(=O)O)c1ccccc1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN2O2/c1-21-11-5-8-16(21)13-22(19(23)24)18-10-3-2-9-17(18)14-6-4-7-15(20)12-14/h2-4,6-7,9-10,12,16H,5,8,11,13H2,1H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | LKIXHFBWRQTSFM-INIZCTEOSA-N |
| XLogP | 4.07 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |