C20H23ClN2O3 — CID 121411430
[2-(3-chlorophenyl)-4-methoxyphenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid (PubChem CID 121411430) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-4-methoxyphenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid.
| Compound Name | [2-(3-chlorophenyl)-4-methoxyphenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 121411430 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [2-(3-chlorophenyl)-4-methoxyphenyl]-[[(2S)-1-methylpyrrolidin-2-yl]methyl]carbamic acid |
| SMILES | COc1ccc(N(C[C@@H]2CCCN2C)C(=O)O)c(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H23ClN2O3/c1-22-10-4-7-16(22)13-23(20(24)25)19-9-8-17(26-2)12-18(19)14-5-3-6-15(21)11-14/h3,5-6,8-9,11-12,16H,4,7,10,13H2,1-2H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | XEFNKZROYPZATN-INIZCTEOSA-N |
| XLogP | 4.59 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |