C19H20Cl2N2O2 — CID 121411498
[4-chloro-2-(3-chlorophenyl)phenyl]-[[(3R)-1-methylpyrrolidin-3-yl]methyl]carbamic acid (PubChem CID 121411498) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is [4-chloro-2-(3-chlorophenyl)phenyl]-[[(3R)-1-methylpyrrolidin-3-yl]methyl]carbamic acid.
| Compound Name | [4-chloro-2-(3-chlorophenyl)phenyl]-[[(3R)-1-methylpyrrolidin-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 121411498 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [4-chloro-2-(3-chlorophenyl)phenyl]-[[(3R)-1-methylpyrrolidin-3-yl]methyl]carbamic acid |
| SMILES | CN1CC[C@@H](CN(C(=O)O)c2ccc(Cl)cc2-c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-22-8-7-13(11-22)12-23(19(24)25)18-6-5-16(21)10-17(18)14-3-2-4-15(20)9-14/h2-6,9-10,13H,7-8,11-12H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | FAFYMQNMDNOEPL-CYBMUJFWSA-N |
| XLogP | 5.10 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |