C19H20ClFN2O2 — CID 121411224
[2-(3-chloro-5-fluorophenyl)phenyl]-[[(3S)-1-methylpyrrolidin-3-yl]methyl]carbamic acid (PubChem CID 121411224) has the molecular formula C19H20ClFN2O2 and a molecular weight of 362.83 g/mol. Its IUPAC name is [2-(3-chloro-5-fluorophenyl)phenyl]-[[(3S)-1-methylpyrrolidin-3-yl]methyl]carbamic acid.
| Compound Name | [2-(3-chloro-5-fluorophenyl)phenyl]-[[(3S)-1-methylpyrrolidin-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 121411224 |
| Molecular Formula | C19H20ClFN2O2 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [2-(3-chloro-5-fluorophenyl)phenyl]-[[(3S)-1-methylpyrrolidin-3-yl]methyl]carbamic acid |
| SMILES | CN1CC[C@H](CN(C(=O)O)c2ccccc2-c2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C19H20ClFN2O2/c1-22-7-6-13(11-22)12-23(19(24)25)18-5-3-2-4-17(18)14-8-15(20)10-16(21)9-14/h2-5,8-10,13H,6-7,11-12H2,1H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | PTFUYBYYWFSJHJ-ZDUSSCGKSA-N |
| XLogP | 4.58 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |