C12H23Cl2N5O2S — CID 119894259
2-(2-methoxyethylamino)-1-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 119894259) has the molecular formula C12H23Cl2N5O2S and a molecular weight of 372.32 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-1-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-1-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119894259 |
| Molecular Formula | C12H23Cl2N5O2S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-1-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | COCCNCC(=O)N1CCN(c2nc(C)ns2)CC1.Cl.Cl |
| InChI | InChI=1S/C12H21N5O2S.2ClH/c1-10-14-12(20-15-10)17-6-4-16(5-7-17)11(18)9-13-3-8-19-2;;/h13H,3-9H2,1-2H3;2*1H |
| InChIKey | QDOPLCKJSAGHKH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|