C13H27Cl2N3O2 — CID 119896717
[3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-morpholin-2-ylmethanone;dihydrochloride (PubChem CID 119896717) has the molecular formula C13H27Cl2N3O2 and a molecular weight of 328.28 g/mol. Its IUPAC name is [3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-morpholin-2-ylmethanone;dihydrochloride.
| Compound Name | [3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-morpholin-2-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119896717 |
| Molecular Formula | C13H27Cl2N3O2 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-morpholin-2-ylmethanone;dihydrochloride |
| SMILES | CCN(C)CC1CCN(C(=O)C2CNCCO2)C1.Cl.Cl |
| InChI | InChI=1S/C13H25N3O2.2ClH/c1-3-15(2)9-11-4-6-16(10-11)13(17)12-8-14-5-7-18-12;;/h11-12,14H,3-10H2,1-2H3;2*1H |
| InChIKey | SSOFNHCQLYDHFO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |