C14H25N3O3 — CID 119899567
(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)-morpholin-3-ylmethanone (PubChem CID 119899567) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)-morpholin-3-ylmethanone.
| Compound Name | (3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)-morpholin-3-ylmethanone |
|---|---|
| PubChem CID | 119899567 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)-morpholin-3-ylmethanone |
| SMILES | CC1CN(C(=O)C2COCCN2)CC1N1CCOCC1 |
| InChI | InChI=1S/C14H25N3O3/c1-11-8-17(14(18)12-10-20-5-2-15-12)9-13(11)16-3-6-19-7-4-16/h11-13,15H,2-10H2,1H3 |
| InChIKey | XOKGTRZNVQJWJA-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |