C20H35Cl2N3O2 — CID 119900615
N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-2-(2-methoxyethylamino)-N-methylacetamide;dihydrochloride (PubChem CID 119900615) has the molecular formula C20H35Cl2N3O2 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-2-(2-methoxyethylamino)-N-methylacetamide;dihydrochloride.
| Compound Name | N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-2-(2-methoxyethylamino)-N-methylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119900615 |
| Molecular Formula | C20H35Cl2N3O2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-2-(2-methoxyethylamino)-N-methylacetamide;dihydrochloride |
| SMILES | COCCNCC(=O)N(C)C1C(C)CN(Cc2ccccc2)CC1C.Cl.Cl |
| InChI | InChI=1S/C20H33N3O2.2ClH/c1-16-13-23(15-18-8-6-5-7-9-18)14-17(2)20(16)22(3)19(24)12-21-10-11-25-4;;/h5-9,16-17,20-21H,10-15H2,1-4H3;2*1H |
| InChIKey | UWXXYOOYCPQXLD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|