C22H39Cl2N3O — CID 119900575
7-amino-N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-N-methylheptanamide;dihydrochloride (PubChem CID 119900575) has the molecular formula C22H39Cl2N3O and a molecular weight of 432.48 g/mol. Its IUPAC name is 7-amino-N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-N-methylheptanamide;dihydrochloride.
| Compound Name | 7-amino-N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-N-methylheptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119900575 |
| Molecular Formula | C22H39Cl2N3O |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 7-amino-N-(1-benzyl-3,5-dimethylpiperidin-4-yl)-N-methylheptanamide;dihydrochloride |
| SMILES | CC1CN(Cc2ccccc2)CC(C)C1N(C)C(=O)CCCCCCN.Cl.Cl |
| InChI | InChI=1S/C22H37N3O.2ClH/c1-18-15-25(17-20-11-7-6-8-12-20)16-19(2)22(18)24(3)21(26)13-9-4-5-10-14-23;;/h6-8,11-12,18-19,22H,4-5,9-10,13-17,23H2,1-3H3;2*1H |
| InChIKey | WNRAAYKNECLTEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|