C29H35NO — CID 11990261
(11R,13S,17R)-13,17-dimethyl-11-[4-(methylamino)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 11990261) has the molecular formula C29H35NO and a molecular weight of 413.61 g/mol. Its IUPAC name is (11R,13S,17R)-13,17-dimethyl-11-[4-(methylamino)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17R)-13,17-dimethyl-11-[4-(methylamino)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11990261 |
| Molecular Formula | C29H35NO |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (11R,13S,17R)-13,17-dimethyl-11-[4-(methylamino)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(C)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(NC)cc3)C[C@@]21C |
| InChI | InChI=1S/C29H35NO/c1-5-15-28(2)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-29(26,28)3)19-6-9-21(30-4)10-7-19/h6-7,9-10,17,24-26,30H,8,11-14,16,18H2,1-4H3/t24?,25-,26?,28-,29+/m1/s1 |
| InChIKey | OAJAPXKKXZAZSQ-FXFDHLSYSA-N |
| XLogP | 6.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|