C14H27Cl3N4OS — CID 119903007
4-(methylamino)-1-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]butan-1-one;trihydrochloride (PubChem CID 119903007) has the molecular formula C14H27Cl3N4OS and a molecular weight of 405.82 g/mol. Its IUPAC name is 4-(methylamino)-1-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]butan-1-one;trihydrochloride.
| Compound Name | 4-(methylamino)-1-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]butan-1-one;trihydrochloride |
|---|---|
| PubChem CID | 119903007 |
| Molecular Formula | C14H27Cl3N4OS |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-(methylamino)-1-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]butan-1-one;trihydrochloride |
| SMILES | CNCCCC(=O)N1CCN(Cc2cnc(C)s2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C14H24N4OS.3ClH/c1-12-16-10-13(20-12)11-17-6-8-18(9-7-17)14(19)4-3-5-15-2;;;/h10,15H,3-9,11H2,1-2H3;3*1H |
| InChIKey | FEPNCVQIXWNKLX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|