C16H29N5O — CID 119903136
N-methyl-4-(methylamino)-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]butanamide (PubChem CID 119903136) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is N-methyl-4-(methylamino)-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]butanamide.
| Compound Name | N-methyl-4-(methylamino)-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 119903136 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | N-methyl-4-(methylamino)-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]butanamide |
| SMILES | CNCCCC(=O)N(C)C1CCN(CCn2cccn2)CC1 |
| InChI | InChI=1S/C16H29N5O/c1-17-8-3-5-16(22)19(2)15-6-11-20(12-7-15)13-14-21-10-4-9-18-21/h4,9-10,15,17H,3,5-8,11-14H2,1-2H3 |
| InChIKey | PRQBOAVVVXSPAO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|