C16H32Cl3N5O — CID 119903137
2-amino-N-methyl-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pentanamide;trihydrochloride (PubChem CID 119903137) has the molecular formula C16H32Cl3N5O and a molecular weight of 416.83 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pentanamide;trihydrochloride.
| Compound Name | 2-amino-N-methyl-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pentanamide;trihydrochloride |
|---|---|
| PubChem CID | 119903137 |
| Molecular Formula | C16H32Cl3N5O |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-amino-N-methyl-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pentanamide;trihydrochloride |
| SMILES | CCCC(N)C(=O)N(C)C1CCN(CCn2cccn2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C16H29N5O.3ClH/c1-3-5-15(17)16(22)19(2)14-6-10-20(11-7-14)12-13-21-9-4-8-18-21;;;/h4,8-9,14-15H,3,5-7,10-13,17H2,1-2H3;3*1H |
| InChIKey | GFUHCLGXMCXKRO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |