C17H27N5O2 — CID 119903688
N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]morpholine-2-carboxamide (PubChem CID 119903688) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]morpholine-2-carboxamide.
| Compound Name | N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119903688 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]morpholine-2-carboxamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)C3CNCCO3)nc2)CC1 |
| InChI | InChI=1S/C17H27N5O2/c1-21(2)13-5-8-22(9-6-13)14-3-4-16(19-11-14)20-17(23)15-12-18-7-10-24-15/h3-4,11,13,15,18H,5-10,12H2,1-2H3,(H,19,20,23) |
| InChIKey | UCNHFWIYZOBCIW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |