C14H26Cl3N5O — CID 119903679
2-amino-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]acetamide;trihydrochloride (PubChem CID 119903679) has the molecular formula C14H26Cl3N5O and a molecular weight of 386.76 g/mol. Its IUPAC name is 2-amino-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]acetamide;trihydrochloride.
| Compound Name | 2-amino-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]acetamide;trihydrochloride |
|---|---|
| PubChem CID | 119903679 |
| Molecular Formula | C14H26Cl3N5O |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-amino-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]acetamide;trihydrochloride |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)CN)nc2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C14H23N5O.3ClH/c1-18(2)11-5-7-19(8-6-11)12-3-4-13(16-10-12)17-14(20)9-15;;;/h3-4,10-11H,5-9,15H2,1-2H3,(H,16,17,20);3*1H |
| InChIKey | ZNIIQVGDCYGDHI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |