C22H26FN5O — CID 166239841
N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]-2-(6-fluoroindol-1-yl)acetamide (PubChem CID 166239841) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]-2-(6-fluoroindol-1-yl)acetamide.
| Compound Name | N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]-2-(6-fluoroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 166239841 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]-2-(6-fluoroindol-1-yl)acetamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)Cn3ccc4ccc(F)cc43)nc2)CC1 |
| InChI | InChI=1S/C22H26FN5O/c1-26(2)18-8-11-27(12-9-18)19-5-6-21(24-14-19)25-22(29)15-28-10-7-16-3-4-17(23)13-20(16)28/h3-7,10,13-14,18H,8-9,11-12,15H2,1-2H3,(H,24,25,29) |
| InChIKey | QMDJVSWPMCUVFF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |