About 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid
1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid (PubChem CID 119904085) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 119904085 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C)N1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-4-13-7-6-8-14(5-2)16(13)19-17(21)12(3)20-10-9-15(11-20)18(22)23/h6-8,12,15H,4-5,9-11H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | BXMOQURENUGXNX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid (CID 119904085) is 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid is CCc1cccc(CC)c1NC(=O)C(C)N1CCC(C(=O)O)C1.
What is the InChIKey of 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid?
The InChIKey is BXMOQURENUGXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O3/c1-4-13-7-6-8-14(5-2)16(13)19-17(21)12(3)20-10-9-15(11-20)18(22)23/h6-8,12,15H,4-5,9-11H2,1-3H3,(H,19,21)(H,22,23).
What are the key properties of 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid?
1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid has a molecular weight of 318.42 g/mol, XLogP of 2.54, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,6-diethylanilino)-1-oxopropan-2-yl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 119904085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).