C18H26N2O2 — CID 82342699
N-(2,6-diethylphenyl)-2-(4-oxopiperidin-1-yl)propanamide (PubChem CID 82342699) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(4-oxopiperidin-1-yl)propanamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(4-oxopiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 82342699 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(4-oxopiperidin-1-yl)propanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C)N1CCC(=O)CC1 |
| InChI | InChI=1S/C18H26N2O2/c1-4-14-7-6-8-15(5-2)17(14)19-18(22)13(3)20-11-9-16(21)10-12-20/h6-8,13H,4-5,9-12H2,1-3H3,(H,19,22) |
| InChIKey | LGTHQLXFVNAJHD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |