C18H28N4O2 — CID 3538975
2-N-(2,6-diethylphenyl)-1-N-propan-2-ylpyrazolidine-1,2-dicarboxamide (PubChem CID 3538975) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-N-(2,6-diethylphenyl)-1-N-propan-2-ylpyrazolidine-1,2-dicarboxamide.
| Compound Name | 2-N-(2,6-diethylphenyl)-1-N-propan-2-ylpyrazolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3538975 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-N-(2,6-diethylphenyl)-1-N-propan-2-ylpyrazolidine-1,2-dicarboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)N1CCCN1C(=O)NC(C)C |
| InChI | InChI=1S/C18H28N4O2/c1-5-14-9-7-10-15(6-2)16(14)20-18(24)22-12-8-11-21(22)17(23)19-13(3)4/h7,9-10,13H,5-6,8,11-12H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | XGULJRNFUNXZMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |