C15H23N3O — CID 82090590
N-(2,6-diethylphenyl)piperazine-1-carboxamide (PubChem CID 82090590) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 82090590 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-(2,6-diethylphenyl)piperazine-1-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H23N3O/c1-3-12-6-5-7-13(4-2)14(12)17-15(19)18-10-8-16-9-11-18/h5-7,16H,3-4,8-11H2,1-2H3,(H,17,19) |
| InChIKey | SIHSKVNIRARWGD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |