C19H31N3O — CID 113110317
4-tert-butyl-N-(2,6-diethylphenyl)piperazine-1-carboxamide (PubChem CID 113110317) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,6-diethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(2,6-diethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110317 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 4-tert-butyl-N-(2,6-diethylphenyl)piperazine-1-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31N3O/c1-6-15-9-8-10-16(7-2)17(15)20-18(23)21-11-13-22(14-12-21)19(3,4)5/h8-10H,6-7,11-14H2,1-5H3,(H,20,23) |
| InChIKey | RBLYCVIAPKYKDA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |