C16H23N5O — CID 82202074
2-[4-(aminomethyl)triazol-1-yl]-N-(2,6-diethylphenyl)propanamide (PubChem CID 82202074) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(2,6-diethylphenyl)propanamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2,6-diethylphenyl)propanamide |
|---|---|
| PubChem CID | 82202074 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2,6-diethylphenyl)propanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C)n1cc(CN)nn1 |
| InChI | InChI=1S/C16H23N5O/c1-4-12-7-6-8-13(5-2)15(12)18-16(22)11(3)21-10-14(9-17)19-20-21/h6-8,10-11H,4-5,9,17H2,1-3H3,(H,18,22) |
| InChIKey | DMWNQUHOOIQNPA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |